C18H23N5O6 — CID 57116116
(2S)-3-[[4-[2-(diaminomethylideneamino)ethoxy]-2-hydroxybenzoyl]amino]-2-(pent-4-ynoylamino)propanoic acid (PubChem CID 57116116) has the molecular formula C18H23N5O6 and a molecular weight of 405.41 g/mol. Its IUPAC name is (2S)-3-[[4-[2-(diaminomethylideneamino)ethoxy]-2-hydroxybenzoyl]amino]-2-(pent-4-ynoylamino)propanoic acid.
| Compound Name | (2S)-3-[[4-[2-(diaminomethylideneamino)ethoxy]-2-hydroxybenzoyl]amino]-2-(pent-4-ynoylamino)propanoic acid |
|---|---|
| PubChem CID | 57116116 |
| Molecular Formula | C18H23N5O6 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | (2S)-3-[[4-[2-(diaminomethylideneamino)ethoxy]-2-hydroxybenzoyl]amino]-2-(pent-4-ynoylamino)propanoic acid |
| SMILES | C#CCCC(=O)N[C@@H](CNC(=O)c1ccc(OCCN=C(N)N)cc1O)C(=O)O |
| InChI | InChI=1S/C18H23N5O6/c1-2-3-4-15(25)23-13(17(27)28)10-22-16(26)12-6-5-11(9-14(12)24)29-8-7-21-18(19)20/h1,5-6,9,13,24H,3-4,7-8,10H2,(H,22,26)(H,23,25)(H,27,28)(H4,19,20,21)/t13-/m0/s1 |
| InChIKey | LNFMQBDUZSXMNR-ZDUSSCGKSA-N |
| XLogP | -1.24 |
| TPSA | 189.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|