C16H23NO5S2 — CID 167771121
3-[2-[(4-butoxy-2-hydroxybenzoyl)amino]ethyldisulfanyl]propanoic acid (PubChem CID 167771121) has the molecular formula C16H23NO5S2 and a molecular weight of 373.50 g/mol. Its IUPAC name is 3-[2-[(4-butoxy-2-hydroxybenzoyl)amino]ethyldisulfanyl]propanoic acid.
| Compound Name | 3-[2-[(4-butoxy-2-hydroxybenzoyl)amino]ethyldisulfanyl]propanoic acid |
|---|---|
| PubChem CID | 167771121 |
| Molecular Formula | C16H23NO5S2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 3-[2-[(4-butoxy-2-hydroxybenzoyl)amino]ethyldisulfanyl]propanoic acid |
| SMILES | CCCCOc1ccc(C(=O)NCCSSCCC(=O)O)c(O)c1 |
| InChI | InChI=1S/C16H23NO5S2/c1-2-3-8-22-12-4-5-13(14(18)11-12)16(21)17-7-10-24-23-9-6-15(19)20/h4-5,11,18H,2-3,6-10H2,1H3,(H,17,21)(H,19,20) |
| InChIKey | GLBXCGLTGQRJAU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|