C24H32N4O6S — CID 139682592
ethyl (2S)-2-[[3-[5-(4-carbamimidoylphenyl)pentanoylamino]-2-methoxyphenyl]sulfonylamino]propanoate (PubChem CID 139682592) has the molecular formula C24H32N4O6S and a molecular weight of 504.61 g/mol. Its IUPAC name is ethyl (2S)-2-[[3-[5-(4-carbamimidoylphenyl)pentanoylamino]-2-methoxyphenyl]sulfonylamino]propanoate.
| Compound Name | ethyl (2S)-2-[[3-[5-(4-carbamimidoylphenyl)pentanoylamino]-2-methoxyphenyl]sulfonylamino]propanoate |
|---|---|
| PubChem CID | 139682592 |
| Molecular Formula | C24H32N4O6S |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | ethyl (2S)-2-[[3-[5-(4-carbamimidoylphenyl)pentanoylamino]-2-methoxyphenyl]sulfonylamino]propanoate |
| SMILES | [H]/N=C(\N)c1ccc(CCCCC(=O)Nc2cccc(S(=O)(=O)N[C@@H](C)C(=O)OCC)c2OC)cc1 |
| InChI | InChI=1S/C24H32N4O6S/c1-4-34-24(30)16(2)28-35(31,32)20-10-7-9-19(22(20)33-3)27-21(29)11-6-5-8-17-12-14-18(15-13-17)23(25)26/h7,9-10,12-16,28H,4-6,8,11H2,1-3H3,(H3,25,26)(H,27,29)/t16-/m0/s1 |
| InChIKey | HAWOBXPUQKMHCO-INIZCTEOSA-N |
| XLogP | 2.56 |
| TPSA | 160.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|