C33H32LiN5O4 — CID 158229837
lithium;3-[4-[3-(4-carbamimidoylphenyl)-2-oxoimidazol-1-yl]phenyl]-2-(dibenzylamino)propanoic acid;hydroxide (PubChem CID 158229837) has the molecular formula C33H32LiN5O4 and a molecular weight of 569.59 g/mol. Its IUPAC name is lithium;3-[4-[3-(4-carbamimidoylphenyl)-2-oxoimidazol-1-yl]phenyl]-2-(dibenzylamino)propanoic acid;hydroxide.
| Compound Name | lithium;3-[4-[3-(4-carbamimidoylphenyl)-2-oxoimidazol-1-yl]phenyl]-2-(dibenzylamino)propanoic acid;hydroxide |
|---|---|
| PubChem CID | 158229837 |
| Molecular Formula | C33H32LiN5O4 |
| Molecular Weight | 569.59 g/mol |
| Exact Mass | 569.26 |
| IUPAC Name | lithium;3-[4-[3-(4-carbamimidoylphenyl)-2-oxoimidazol-1-yl]phenyl]-2-(dibenzylamino)propanoic acid;hydroxide |
| SMILES | [H]/N=C(\N)c1ccc(-n2ccn(-c3ccc(CC(C(=O)O)N(Cc4ccccc4)Cc4ccccc4)cc3)c2=O)cc1.[Li+].[OH-] |
| InChI | InChI=1S/C33H31N5O3.Li.H2O/c34-31(35)27-13-17-29(18-14-27)38-20-19-37(33(38)41)28-15-11-24(12-16-28)21-30(32(39)40)36(22-25-7-3-1-4-8-25)23-26-9-5-2-6-10-26;;/h1-20,30H,21-23H2,(H3,34,35)(H,39,40);;1H2/q;+1;/p-1 |
| InChIKey | GEFYKFAUQCPOBI-UHFFFAOYSA-M |
| XLogP | 1.44 |
| TPSA | 147.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.59 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|