C26H29F3N4O9S — CID 158567233
(2S)-2-[[[5-(4-carbamimidoylphenoxy)carbonylthiophen-2-yl]methyl-cyclohexylcarbamoyl]amino]butanedioic acid;2,2,2-trifluoroacetic acid (PubChem CID 158567233) has the molecular formula C26H29F3N4O9S and a molecular weight of 630.60 g/mol. Its IUPAC name is (2S)-2-[[[5-(4-carbamimidoylphenoxy)carbonylthiophen-2-yl]methyl-cyclohexylcarbamoyl]amino]butanedioic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-2-[[[5-(4-carbamimidoylphenoxy)carbonylthiophen-2-yl]methyl-cyclohexylcarbamoyl]amino]butanedioic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 158567233 |
| Molecular Formula | C26H29F3N4O9S |
| Molecular Weight | 630.60 g/mol |
| Exact Mass | 630.16 |
| IUPAC Name | (2S)-2-[[[5-(4-carbamimidoylphenoxy)carbonylthiophen-2-yl]methyl-cyclohexylcarbamoyl]amino]butanedioic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(OC(=O)c2ccc(CN(C(=O)N[C@@H](CC(=O)O)C(=O)O)C3CCCCC3)s2)cc1 |
| InChI | InChI=1S/C24H28N4O7S.C2HF3O2/c25-21(26)14-6-8-16(9-7-14)35-23(33)19-11-10-17(36-19)13-28(15-4-2-1-3-5-15)24(34)27-18(22(31)32)12-20(29)30;3-2(4,5)1(6)7/h6-11,15,18H,1-5,12-13H2,(H3,25,26)(H,27,34)(H,29,30)(H,31,32);(H,6,7)/t18-;/m0./s1 |
| InChIKey | IWXMPGBEMRPEIZ-FERBBOLQSA-N |
| XLogP | 3.66 |
| TPSA | 220.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.60 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|