C18H19F3N4O6S — CID 162319070
(4-carbamimidoylphenyl) 2-[(3-methoxy-3-oxopropyl)-methylamino]-1,3-thiazole-5-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 162319070) has the molecular formula C18H19F3N4O6S and a molecular weight of 476.43 g/mol. Its IUPAC name is (4-carbamimidoylphenyl) 2-[(3-methoxy-3-oxopropyl)-methylamino]-1,3-thiazole-5-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | (4-carbamimidoylphenyl) 2-[(3-methoxy-3-oxopropyl)-methylamino]-1,3-thiazole-5-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 162319070 |
| Molecular Formula | C18H19F3N4O6S |
| Molecular Weight | 476.43 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | (4-carbamimidoylphenyl) 2-[(3-methoxy-3-oxopropyl)-methylamino]-1,3-thiazole-5-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(OC(=O)c2cnc(N(C)CCC(=O)OC)s2)cc1 |
| InChI | InChI=1S/C16H18N4O4S.C2HF3O2/c1-20(8-7-13(21)23-2)16-19-9-12(25-16)15(22)24-11-5-3-10(4-6-11)14(17)18;3-2(4,5)1(6)7/h3-6,9H,7-8H2,1-2H3,(H3,17,18);(H,6,7) |
| InChIKey | XTIWEHLVHDCRJF-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 155.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.43 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|