C14H14N2O4S — CID 153362299
phenyl 2-[(3-methoxy-3-oxopropyl)amino]-1,3-thiazole-5-carboxylate (PubChem CID 153362299) has the molecular formula C14H14N2O4S and a molecular weight of 306.34 g/mol. Its IUPAC name is phenyl 2-[(3-methoxy-3-oxopropyl)amino]-1,3-thiazole-5-carboxylate.
| Compound Name | phenyl 2-[(3-methoxy-3-oxopropyl)amino]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 153362299 |
| Molecular Formula | C14H14N2O4S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | phenyl 2-[(3-methoxy-3-oxopropyl)amino]-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)CCNc1ncc(C(=O)Oc2ccccc2)s1 |
| InChI | InChI=1S/C14H14N2O4S/c1-19-12(17)7-8-15-14-16-9-11(21-14)13(18)20-10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3,(H,15,16) |
| InChIKey | NNVXZGFRSZWOGZ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|