C11H19N3O2S — CID 80571028
methyl 2-[4-(dimethylamino)butylamino]-1,3-thiazole-5-carboxylate (PubChem CID 80571028) has the molecular formula C11H19N3O2S and a molecular weight of 257.36 g/mol. Its IUPAC name is methyl 2-[4-(dimethylamino)butylamino]-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-[4-(dimethylamino)butylamino]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 80571028 |
| Molecular Formula | C11H19N3O2S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | methyl 2-[4-(dimethylamino)butylamino]-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1cnc(NCCCCN(C)C)s1 |
| InChI | InChI=1S/C11H19N3O2S/c1-14(2)7-5-4-6-12-11-13-8-9(17-11)10(15)16-3/h8H,4-7H2,1-3H3,(H,12,13) |
| InChIKey | HSQSLJIVYRQGIQ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|