C15H19N3O2S — CID 80569027
methyl 2-[3-(N-methylanilino)propylamino]-1,3-thiazole-5-carboxylate (PubChem CID 80569027) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is methyl 2-[3-(N-methylanilino)propylamino]-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-[3-(N-methylanilino)propylamino]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 80569027 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | methyl 2-[3-(N-methylanilino)propylamino]-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1cnc(NCCCN(C)c2ccccc2)s1 |
| InChI | InChI=1S/C15H19N3O2S/c1-18(12-7-4-3-5-8-12)10-6-9-16-15-17-11-13(21-15)14(19)20-2/h3-5,7-8,11H,6,9-10H2,1-2H3,(H,16,17) |
| InChIKey | AHHPJKZBLYBJNA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|