C16H20N2O4S2 — CID 3761777
methyl 3-[3-(N-methylanilino)propylsulfamoyl]thiophene-2-carboxylate (PubChem CID 3761777) has the molecular formula C16H20N2O4S2 and a molecular weight of 368.48 g/mol. Its IUPAC name is methyl 3-[3-(N-methylanilino)propylsulfamoyl]thiophene-2-carboxylate.
| Compound Name | methyl 3-[3-(N-methylanilino)propylsulfamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 3761777 |
| Molecular Formula | C16H20N2O4S2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | methyl 3-[3-(N-methylanilino)propylsulfamoyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1S(=O)(=O)NCCCN(C)c1ccccc1 |
| InChI | InChI=1S/C16H20N2O4S2/c1-18(13-7-4-3-5-8-13)11-6-10-17-24(20,21)14-9-12-23-15(14)16(19)22-2/h3-5,7-9,12,17H,6,10-11H2,1-2H3 |
| InChIKey | DZDPZNACMSHPFV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|