C15H29NO4S2 — CID 142506326
methyl 3-(hexylsulfamoyl)thiophene-2-carboxylate;molecular hydrogen;propane (PubChem CID 142506326) has the molecular formula C15H29NO4S2 and a molecular weight of 351.53 g/mol. Its IUPAC name is methyl 3-(hexylsulfamoyl)thiophene-2-carboxylate;molecular hydrogen;propane.
| Compound Name | methyl 3-(hexylsulfamoyl)thiophene-2-carboxylate;molecular hydrogen;propane |
|---|---|
| PubChem CID | 142506326 |
| Molecular Formula | C15H29NO4S2 |
| Molecular Weight | 351.53 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | methyl 3-(hexylsulfamoyl)thiophene-2-carboxylate;molecular hydrogen;propane |
| SMILES | CCC.CCCCCCNS(=O)(=O)c1ccsc1C(=O)OC.[H][H] |
| InChI | InChI=1S/C12H19NO4S2.C3H8.H2/c1-3-4-5-6-8-13-19(15,16)10-7-9-18-11(10)12(14)17-2;1-3-2;/h7,9,13H,3-6,8H2,1-2H3;3H2,1-2H3;1H |
| InChIKey | IQUAFMXBHMWCFQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.53 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|