C16H21N3O6S3 — CID 55488459
methyl 3-[[2-(butylamino)-5-sulfamoylphenyl]sulfamoyl]thiophene-2-carboxylate (PubChem CID 55488459) has the molecular formula C16H21N3O6S3 and a molecular weight of 447.56 g/mol. Its IUPAC name is methyl 3-[[2-(butylamino)-5-sulfamoylphenyl]sulfamoyl]thiophene-2-carboxylate.
| Compound Name | methyl 3-[[2-(butylamino)-5-sulfamoylphenyl]sulfamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 55488459 |
| Molecular Formula | C16H21N3O6S3 |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.06 |
| IUPAC Name | methyl 3-[[2-(butylamino)-5-sulfamoylphenyl]sulfamoyl]thiophene-2-carboxylate |
| SMILES | CCCCNc1ccc(S(N)(=O)=O)cc1NS(=O)(=O)c1ccsc1C(=O)OC |
| InChI | InChI=1S/C16H21N3O6S3/c1-3-4-8-18-12-6-5-11(27(17,21)22)10-13(12)19-28(23,24)14-7-9-26-15(14)16(20)25-2/h5-7,9-10,18-19H,3-4,8H2,1-2H3,(H2,17,21,22) |
| InChIKey | MKZMNSSWPQFEQO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 144.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|