C17H23N3O4S2 — CID 47784526
4-(butylamino)-3-[(3-methylphenyl)sulfonylamino]benzenesulfonamide (PubChem CID 47784526) has the molecular formula C17H23N3O4S2 and a molecular weight of 397.52 g/mol. Its IUPAC name is 4-(butylamino)-3-[(3-methylphenyl)sulfonylamino]benzenesulfonamide.
| Compound Name | 4-(butylamino)-3-[(3-methylphenyl)sulfonylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 47784526 |
| Molecular Formula | C17H23N3O4S2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 4-(butylamino)-3-[(3-methylphenyl)sulfonylamino]benzenesulfonamide |
| SMILES | CCCCNc1ccc(S(N)(=O)=O)cc1NS(=O)(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C17H23N3O4S2/c1-3-4-10-19-16-9-8-14(25(18,21)22)12-17(16)20-26(23,24)15-7-5-6-13(2)11-15/h5-9,11-12,19-20H,3-4,10H2,1-2H3,(H2,18,21,22) |
| InChIKey | BSAVNLSYCAFTBE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|