C17H22N4O7S2 — CID 55488154
4-(butylamino)-3-[(4-methoxy-3-nitrophenyl)sulfonylamino]benzenesulfonamide (PubChem CID 55488154) has the molecular formula C17H22N4O7S2 and a molecular weight of 458.52 g/mol. Its IUPAC name is 4-(butylamino)-3-[(4-methoxy-3-nitrophenyl)sulfonylamino]benzenesulfonamide.
| Compound Name | 4-(butylamino)-3-[(4-methoxy-3-nitrophenyl)sulfonylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 55488154 |
| Molecular Formula | C17H22N4O7S2 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | 4-(butylamino)-3-[(4-methoxy-3-nitrophenyl)sulfonylamino]benzenesulfonamide |
| SMILES | CCCCNc1ccc(S(N)(=O)=O)cc1NS(=O)(=O)c1ccc(OC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H22N4O7S2/c1-3-4-9-19-14-7-5-12(29(18,24)25)10-15(14)20-30(26,27)13-6-8-17(28-2)16(11-13)21(22)23/h5-8,10-11,19-20H,3-4,9H2,1-2H3,(H2,18,24,25) |
| InChIKey | KVPKUKIEDKRWOH-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 170.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|