C16H20N4O6S2 — CID 30868360
2-methyl-5-nitro-N-[2-(propylamino)-5-sulfamoylphenyl]benzenesulfonamide (PubChem CID 30868360) has the molecular formula C16H20N4O6S2 and a molecular weight of 428.49 g/mol. Its IUPAC name is 2-methyl-5-nitro-N-[2-(propylamino)-5-sulfamoylphenyl]benzenesulfonamide.
| Compound Name | 2-methyl-5-nitro-N-[2-(propylamino)-5-sulfamoylphenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 30868360 |
| Molecular Formula | C16H20N4O6S2 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | 2-methyl-5-nitro-N-[2-(propylamino)-5-sulfamoylphenyl]benzenesulfonamide |
| SMILES | CCCNc1ccc(S(N)(=O)=O)cc1NS(=O)(=O)c1cc([N+](=O)[O-])ccc1C |
| InChI | InChI=1S/C16H20N4O6S2/c1-3-8-18-14-7-6-13(27(17,23)24)10-15(14)19-28(25,26)16-9-12(20(21)22)5-4-11(16)2/h4-7,9-10,18-19H,3,8H2,1-2H3,(H2,17,23,24) |
| InChIKey | RSVDZWPRGSQSOU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 161.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|