C17H21FN2O2S — CID 46534961
4-fluoro-2-methyl-N-[3-(N-methylanilino)propyl]benzenesulfonamide (PubChem CID 46534961) has the molecular formula C17H21FN2O2S and a molecular weight of 336.43 g/mol. Its IUPAC name is 4-fluoro-2-methyl-N-[3-(N-methylanilino)propyl]benzenesulfonamide.
| Compound Name | 4-fluoro-2-methyl-N-[3-(N-methylanilino)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 46534961 |
| Molecular Formula | C17H21FN2O2S |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 4-fluoro-2-methyl-N-[3-(N-methylanilino)propyl]benzenesulfonamide |
| SMILES | Cc1cc(F)ccc1S(=O)(=O)NCCCN(C)c1ccccc1 |
| InChI | InChI=1S/C17H21FN2O2S/c1-14-13-15(18)9-10-17(14)23(21,22)19-11-6-12-20(2)16-7-4-3-5-8-16/h3-5,7-10,13,19H,6,11-12H2,1-2H3 |
| InChIKey | JXSJTONGGGUODX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|