C22H24F3N5O7S — CID 162325325
(4-carbamimidoylphenyl) 2-[4-[(2-methoxy-2-oxoethyl)carbamoyl]piperidin-1-yl]-1,3-thiazole-5-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 162325325) has the molecular formula C22H24F3N5O7S and a molecular weight of 559.52 g/mol. Its IUPAC name is (4-carbamimidoylphenyl) 2-[4-[(2-methoxy-2-oxoethyl)carbamoyl]piperidin-1-yl]-1,3-thiazole-5-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | (4-carbamimidoylphenyl) 2-[4-[(2-methoxy-2-oxoethyl)carbamoyl]piperidin-1-yl]-1,3-thiazole-5-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 162325325 |
| Molecular Formula | C22H24F3N5O7S |
| Molecular Weight | 559.52 g/mol |
| Exact Mass | 559.13 |
| IUPAC Name | (4-carbamimidoylphenyl) 2-[4-[(2-methoxy-2-oxoethyl)carbamoyl]piperidin-1-yl]-1,3-thiazole-5-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(OC(=O)c2cnc(N3CCC(C(=O)NCC(=O)OC)CC3)s2)cc1 |
| InChI | InChI=1S/C20H23N5O5S.C2HF3O2/c1-29-16(26)11-23-18(27)13-6-8-25(9-7-13)20-24-10-15(31-20)19(28)30-14-4-2-12(3-5-14)17(21)22;3-2(4,5)1(6)7/h2-5,10,13H,6-9,11H2,1H3,(H3,21,22)(H,23,27);(H,6,7) |
| InChIKey | CPJSHZKYPOHEGR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 185.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.52 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|