C21H25N3O7S2 — CID 74982961
2-[[(E)-3-[5-(4-carbamimidoylphenoxy)carbonylthiophen-2-yl]-2-methylprop-2-enoyl]-(3-hydroxypropyl)amino]ethanesulfonic acid (PubChem CID 74982961) has the molecular formula C21H25N3O7S2 and a molecular weight of 495.58 g/mol. Its IUPAC name is 2-[[(E)-3-[5-(4-carbamimidoylphenoxy)carbonylthiophen-2-yl]-2-methylprop-2-enoyl]-(3-hydroxypropyl)amino]ethanesulfonic acid.
| Compound Name | 2-[[(E)-3-[5-(4-carbamimidoylphenoxy)carbonylthiophen-2-yl]-2-methylprop-2-enoyl]-(3-hydroxypropyl)amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 74982961 |
| Molecular Formula | C21H25N3O7S2 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | 2-[[(E)-3-[5-(4-carbamimidoylphenoxy)carbonylthiophen-2-yl]-2-methylprop-2-enoyl]-(3-hydroxypropyl)amino]ethanesulfonic acid |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)c2ccc(/C=C(\C)C(=O)N(CCCO)CCS(=O)(=O)O)s2)cc1 |
| InChI | InChI=1S/C21H25N3O7S2/c1-14(20(26)24(9-2-11-25)10-12-33(28,29)30)13-17-7-8-18(32-17)21(27)31-16-5-3-15(4-6-16)19(22)23/h3-8,13,25H,2,9-12H2,1H3,(H3,22,23)(H,28,29,30)/b14-13+ |
| InChIKey | HESPFXXTEAPSNR-BUHFOSPRSA-N |
| XLogP | 1.75 |
| TPSA | 171.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|