C20H22N4O6S — CID 74983027
2-[[(E)-3-[4-(4-carbamimidoylphenoxy)carbonyl-1,3-thiazol-2-yl]-2-methylprop-2-enoyl]-(3-hydroxypropyl)amino]acetic acid (PubChem CID 74983027) has the molecular formula C20H22N4O6S and a molecular weight of 446.49 g/mol. Its IUPAC name is 2-[[(E)-3-[4-(4-carbamimidoylphenoxy)carbonyl-1,3-thiazol-2-yl]-2-methylprop-2-enoyl]-(3-hydroxypropyl)amino]acetic acid.
| Compound Name | 2-[[(E)-3-[4-(4-carbamimidoylphenoxy)carbonyl-1,3-thiazol-2-yl]-2-methylprop-2-enoyl]-(3-hydroxypropyl)amino]acetic acid |
|---|---|
| PubChem CID | 74983027 |
| Molecular Formula | C20H22N4O6S |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 2-[[(E)-3-[4-(4-carbamimidoylphenoxy)carbonyl-1,3-thiazol-2-yl]-2-methylprop-2-enoyl]-(3-hydroxypropyl)amino]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)c2csc(/C=C(\C)C(=O)N(CCCO)CC(=O)O)n2)cc1 |
| InChI | InChI=1S/C20H22N4O6S/c1-12(19(28)24(7-2-8-25)10-17(26)27)9-16-23-15(11-31-16)20(29)30-14-5-3-13(4-6-14)18(21)22/h3-6,9,11,25H,2,7-8,10H2,1H3,(H3,21,22)(H,26,27)/b12-9+ |
| InChIKey | SBYSYEMARSDRIB-FMIVXFBMSA-N |
| XLogP | 1.35 |
| TPSA | 166.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|