C25H37N5O6S — CID 70278950
acetic acid;methyl 3-[[2-(4-carbamimidoylbenzoyl)imino-3-hexyl-4-methyl-1,3-thiazolidine-5-carbonyl]amino]propanoate (PubChem CID 70278950) has the molecular formula C25H37N5O6S and a molecular weight of 535.67 g/mol. Its IUPAC name is acetic acid;methyl 3-[[2-(4-carbamimidoylbenzoyl)imino-3-hexyl-4-methyl-1,3-thiazolidine-5-carbonyl]amino]propanoate.
| Compound Name | acetic acid;methyl 3-[[2-(4-carbamimidoylbenzoyl)imino-3-hexyl-4-methyl-1,3-thiazolidine-5-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 70278950 |
| Molecular Formula | C25H37N5O6S |
| Molecular Weight | 535.67 g/mol |
| Exact Mass | 535.25 |
| IUPAC Name | acetic acid;methyl 3-[[2-(4-carbamimidoylbenzoyl)imino-3-hexyl-4-methyl-1,3-thiazolidine-5-carbonyl]amino]propanoate |
| SMILES | CC(=O)O.[H]/N=C(\N)c1ccc(C(=O)/N=C2/SC(C(=O)NCCC(=O)OC)C(C)N2CCCCCC)cc1 |
| InChI | InChI=1S/C23H33N5O4S.C2H4O2/c1-4-5-6-7-14-28-15(2)19(22(31)26-13-12-18(29)32-3)33-23(28)27-21(30)17-10-8-16(9-11-17)20(24)25;1-2(3)4/h8-11,15,19H,4-7,12-14H2,1-3H3,(H3,24,25)(H,26,31);1H3,(H,3,4)/b27-23+; |
| InChIKey | WZYHTAICYUNEFE-VZXOMLSWSA-N |
| XLogP | 2.62 |
| TPSA | 175.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.67 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|