C20H24N4O4S2 — CID 54544555
methyl 3-[[2-(4-carbamothioylbenzoyl)imino-3-cyclopropyl-4-methyl-1,3-thiazolidine-5-carbonyl]amino]propanoate (PubChem CID 54544555) has the molecular formula C20H24N4O4S2 and a molecular weight of 448.57 g/mol. Its IUPAC name is methyl 3-[[2-(4-carbamothioylbenzoyl)imino-3-cyclopropyl-4-methyl-1,3-thiazolidine-5-carbonyl]amino]propanoate.
| Compound Name | methyl 3-[[2-(4-carbamothioylbenzoyl)imino-3-cyclopropyl-4-methyl-1,3-thiazolidine-5-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 54544555 |
| Molecular Formula | C20H24N4O4S2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | methyl 3-[[2-(4-carbamothioylbenzoyl)imino-3-cyclopropyl-4-methyl-1,3-thiazolidine-5-carbonyl]amino]propanoate |
| SMILES | COC(=O)CCNC(=O)C1S/C(=N\C(=O)c2ccc(C(N)=S)cc2)N(C2CC2)C1C |
| InChI | InChI=1S/C20H24N4O4S2/c1-11-16(19(27)22-10-9-15(25)28-2)30-20(24(11)14-7-8-14)23-18(26)13-5-3-12(4-6-13)17(21)29/h3-6,11,14,16H,7-10H2,1-2H3,(H2,21,29)(H,22,27)/b23-20- |
| InChIKey | ZFPPMSDQIRQRDO-ATJXCDBQSA-N |
| XLogP | 1.46 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|