C19H25N5O4S — CID 67724015
methyl 3-[[2-(4-carbamimidoylbenzoyl)imino-4-ethyl-3-methyl-1,3-thiazolidine-5-carbonyl]amino]propanoate (PubChem CID 67724015) has the molecular formula C19H25N5O4S and a molecular weight of 419.51 g/mol. Its IUPAC name is methyl 3-[[2-(4-carbamimidoylbenzoyl)imino-4-ethyl-3-methyl-1,3-thiazolidine-5-carbonyl]amino]propanoate.
| Compound Name | methyl 3-[[2-(4-carbamimidoylbenzoyl)imino-4-ethyl-3-methyl-1,3-thiazolidine-5-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 67724015 |
| Molecular Formula | C19H25N5O4S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | methyl 3-[[2-(4-carbamimidoylbenzoyl)imino-4-ethyl-3-methyl-1,3-thiazolidine-5-carbonyl]amino]propanoate |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)/N=C2/SC(C(=O)NCCC(=O)OC)C(CC)N2C)cc1 |
| InChI | InChI=1S/C19H25N5O4S/c1-4-13-15(18(27)22-10-9-14(25)28-3)29-19(24(13)2)23-17(26)12-7-5-11(6-8-12)16(20)21/h5-8,13,15H,4,9-10H2,1-3H3,(H3,20,21)(H,22,27)/b23-19+ |
| InChIKey | RFLJEGUWRPXVCW-FCDQGJHFSA-N |
| XLogP | 0.97 |
| TPSA | 137.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|