C19H26IN5O4S — CID 70277144
methyl 3-[[3,4-dimethyl-2-[4-(N'-methylcarbamimidoyl)benzoyl]imino-1,3-thiazolidine-5-carbonyl]amino]propanoate;hydroiodide (PubChem CID 70277144) has the molecular formula C19H26IN5O4S and a molecular weight of 547.42 g/mol. Its IUPAC name is methyl 3-[[3,4-dimethyl-2-[4-(N'-methylcarbamimidoyl)benzoyl]imino-1,3-thiazolidine-5-carbonyl]amino]propanoate;hydroiodide.
| Compound Name | methyl 3-[[3,4-dimethyl-2-[4-(N'-methylcarbamimidoyl)benzoyl]imino-1,3-thiazolidine-5-carbonyl]amino]propanoate;hydroiodide |
|---|---|
| PubChem CID | 70277144 |
| Molecular Formula | C19H26IN5O4S |
| Molecular Weight | 547.42 g/mol |
| Exact Mass | 547.08 |
| IUPAC Name | methyl 3-[[3,4-dimethyl-2-[4-(N'-methylcarbamimidoyl)benzoyl]imino-1,3-thiazolidine-5-carbonyl]amino]propanoate;hydroiodide |
| SMILES | C/N=C(\N)c1ccc(C(=O)/N=C2/SC(C(=O)NCCC(=O)OC)C(C)N2C)cc1.I |
| InChI | InChI=1S/C19H25N5O4S.HI/c1-11-15(18(27)22-10-9-14(25)28-4)29-19(24(11)3)23-17(26)13-7-5-12(6-8-13)16(20)21-2;/h5-8,11,15H,9-10H2,1-4H3,(H2,20,21)(H,22,27);1H/b23-19+; |
| InChIKey | CMZKJYWKNPJGJM-IMPZXOFZSA-N |
| XLogP | 1.25 |
| TPSA | 126.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.42 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|