C36H44F3N5O8S — CID 67682088
3-[[2-[4-[N'-(4-cyclohexyloxy-4-oxobutyl)carbamimidoyl]benzoyl]imino-4-methyl-3-(2-phenylethyl)-1,3-thiazolidine-5-carbonyl]amino]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 67682088) has the molecular formula C36H44F3N5O8S and a molecular weight of 763.84 g/mol. Its IUPAC name is 3-[[2-[4-[N'-(4-cyclohexyloxy-4-oxobutyl)carbamimidoyl]benzoyl]imino-4-methyl-3-(2-phenylethyl)-1,3-thiazolidine-5-carbonyl]amino]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[[2-[4-[N'-(4-cyclohexyloxy-4-oxobutyl)carbamimidoyl]benzoyl]imino-4-methyl-3-(2-phenylethyl)-1,3-thiazolidine-5-carbonyl]amino]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67682088 |
| Molecular Formula | C36H44F3N5O8S |
| Molecular Weight | 763.84 g/mol |
| Exact Mass | 763.29 |
| IUPAC Name | 3-[[2-[4-[N'-(4-cyclohexyloxy-4-oxobutyl)carbamimidoyl]benzoyl]imino-4-methyl-3-(2-phenylethyl)-1,3-thiazolidine-5-carbonyl]amino]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CC1C(C(=O)NCCC(=O)O)S/C(=N/C(=O)c2ccc(/C(N)=N/CCCC(=O)OC3CCCCC3)cc2)N1CCc1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C34H43N5O6S.C2HF3O2/c1-23-30(33(44)37-21-18-28(40)41)46-34(39(23)22-19-24-9-4-2-5-10-24)38-32(43)26-16-14-25(15-17-26)31(35)36-20-8-13-29(42)45-27-11-6-3-7-12-27;3-2(4,5)1(6)7/h2,4-5,9-10,14-17,23,27,30H,3,6-8,11-13,18-22H2,1H3,(H2,35,36)(H,37,44)(H,40,41);(H,6,7)/b38-34+; |
| InChIKey | DFXZFFAHSZZNCL-XPVOFEIOSA-N |
| XLogP | 4.82 |
| TPSA | 201.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.84 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|