C28H39N5O6S — CID 67708397
5-[[amino-[4-[[5-(2-carboxyethylcarbamoyl)-3-cyclohexyl-4-methyl-1,3-thiazolidin-2-ylidene]carbamoyl]phenyl]methylidene]amino]-2-methylpentanoic acid (PubChem CID 67708397) has the molecular formula C28H39N5O6S and a molecular weight of 573.72 g/mol. Its IUPAC name is 5-[[amino-[4-[[5-(2-carboxyethylcarbamoyl)-3-cyclohexyl-4-methyl-1,3-thiazolidin-2-ylidene]carbamoyl]phenyl]methylidene]amino]-2-methylpentanoic acid.
| Compound Name | 5-[[amino-[4-[[5-(2-carboxyethylcarbamoyl)-3-cyclohexyl-4-methyl-1,3-thiazolidin-2-ylidene]carbamoyl]phenyl]methylidene]amino]-2-methylpentanoic acid |
|---|---|
| PubChem CID | 67708397 |
| Molecular Formula | C28H39N5O6S |
| Molecular Weight | 573.72 g/mol |
| Exact Mass | 573.26 |
| IUPAC Name | 5-[[amino-[4-[[5-(2-carboxyethylcarbamoyl)-3-cyclohexyl-4-methyl-1,3-thiazolidin-2-ylidene]carbamoyl]phenyl]methylidene]amino]-2-methylpentanoic acid |
| SMILES | CC(CCC/N=C(\N)c1ccc(C(=O)/N=C2\SC(C(=O)NCCC(=O)O)C(C)N2C2CCCCC2)cc1)C(=O)O |
| InChI | InChI=1S/C28H39N5O6S/c1-17(27(38)39)7-6-15-30-24(29)19-10-12-20(13-11-19)25(36)32-28-33(21-8-4-3-5-9-21)18(2)23(40-28)26(37)31-16-14-22(34)35/h10-13,17-18,21,23H,3-9,14-16H2,1-2H3,(H2,29,30)(H,31,37)(H,34,35)(H,38,39)/b32-28- |
| InChIKey | JSTCXSTWFASKKM-BLCKFSMSSA-N |
| XLogP | 3.12 |
| TPSA | 174.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.72 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|