C35H47N7O3 — CID 89149094
N-[2-[[(2S)-1-[[(2S)-2-(cyclohexanecarbonylamino)-2-phenylethyl]-methylamino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]ethyl]naphthalene-2-carboxamide (PubChem CID 89149094) has the molecular formula C35H47N7O3 and a molecular weight of 613.81 g/mol. Its IUPAC name is N-[2-[[(2S)-1-[[(2S)-2-(cyclohexanecarbonylamino)-2-phenylethyl]-methylamino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]ethyl]naphthalene-2-carboxamide.
| Compound Name | N-[2-[[(2S)-1-[[(2S)-2-(cyclohexanecarbonylamino)-2-phenylethyl]-methylamino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]ethyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 89149094 |
| Molecular Formula | C35H47N7O3 |
| Molecular Weight | 613.81 g/mol |
| Exact Mass | 613.37 |
| IUPAC Name | N-[2-[[(2S)-1-[[(2S)-2-(cyclohexanecarbonylamino)-2-phenylethyl]-methylamino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]ethyl]naphthalene-2-carboxamide |
| SMILES | CN(C[C@@H](NC(=O)C1CCCCC1)c1ccccc1)C(=O)[C@H](CCCN=C(N)N)NCCNC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C35H47N7O3/c1-42(24-31(26-12-4-2-5-13-26)41-33(44)27-14-6-3-7-15-27)34(45)30(17-10-20-40-35(36)37)38-21-22-39-32(43)29-19-18-25-11-8-9-16-28(25)23-29/h2,4-5,8-9,11-13,16,18-19,23,27,30-31,38H,3,6-7,10,14-15,17,20-22,24H2,1H3,(H,39,43)(H,41,44)(H4,36,37,40)/t30-,31+/m0/s1 |
| InChIKey | WVRAQOGGSAELKD-IOWSJCHKSA-N |
| XLogP | 3.48 |
| TPSA | 154.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.81 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|