C32H39N7O4 — CID 11685697
N-[(2S)-1-[[(2S)-1-amino-3-naphthalen-2-yl-1-oxopropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-benzoylpiperidine-4-carboxamide (PubChem CID 11685697) has the molecular formula C32H39N7O4 and a molecular weight of 585.71 g/mol. Its IUPAC name is N-[(2S)-1-[[(2S)-1-amino-3-naphthalen-2-yl-1-oxopropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-benzoylpiperidine-4-carboxamide.
| Compound Name | N-[(2S)-1-[[(2S)-1-amino-3-naphthalen-2-yl-1-oxopropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-benzoylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 11685697 |
| Molecular Formula | C32H39N7O4 |
| Molecular Weight | 585.71 g/mol |
| Exact Mass | 585.31 |
| IUPAC Name | N-[(2S)-1-[[(2S)-1-amino-3-naphthalen-2-yl-1-oxopropan-2-yl]amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-1-benzoylpiperidine-4-carboxamide |
| SMILES | NC(=O)[C@H](Cc1ccc2ccccc2c1)NC(=O)[C@H](CCCN=C(N)N)NC(=O)C1CCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C32H39N7O4/c33-28(40)27(20-21-12-13-22-7-4-5-10-25(22)19-21)38-30(42)26(11-6-16-36-32(34)35)37-29(41)23-14-17-39(18-15-23)31(43)24-8-2-1-3-9-24/h1-5,7-10,12-13,19,23,26-27H,6,11,14-18,20H2,(H2,33,40)(H,37,41)(H,38,42)(H4,34,35,36)/t26-,27-/m0/s1 |
| InChIKey | HMWRVOFMPBZYIE-SVBPBHIXSA-N |
| XLogP | 1.44 |
| TPSA | 186.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.71 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|