C35H49N7O7 — CID 3829991
5-(diaminomethylideneamino)-2-[[4-methyl-2-[[3-phenyl-2-[(1-phenylmethoxycarbonylpiperidine-4-carbonyl)amino]propanoyl]amino]pentanoyl]amino]pentanoic acid (PubChem CID 3829991) has the molecular formula C35H49N7O7 and a molecular weight of 679.82 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-2-[[4-methyl-2-[[3-phenyl-2-[(1-phenylmethoxycarbonylpiperidine-4-carbonyl)amino]propanoyl]amino]pentanoyl]amino]pentanoic acid.
| Compound Name | 5-(diaminomethylideneamino)-2-[[4-methyl-2-[[3-phenyl-2-[(1-phenylmethoxycarbonylpiperidine-4-carbonyl)amino]propanoyl]amino]pentanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 3829991 |
| Molecular Formula | C35H49N7O7 |
| Molecular Weight | 679.82 g/mol |
| Exact Mass | 679.37 |
| IUPAC Name | 5-(diaminomethylideneamino)-2-[[4-methyl-2-[[3-phenyl-2-[(1-phenylmethoxycarbonylpiperidine-4-carbonyl)amino]propanoyl]amino]pentanoyl]amino]pentanoic acid |
| SMILES | CC(C)CC(NC(=O)C(Cc1ccccc1)NC(=O)C1CCN(C(=O)OCc2ccccc2)CC1)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C35H49N7O7/c1-23(2)20-28(31(44)39-27(33(46)47)14-9-17-38-34(36)37)41-32(45)29(21-24-10-5-3-6-11-24)40-30(43)26-15-18-42(19-16-26)35(48)49-22-25-12-7-4-8-13-25/h3-8,10-13,23,26-29H,9,14-22H2,1-2H3,(H,39,44)(H,40,43)(H,41,45)(H,46,47)(H4,36,37,38) |
| InChIKey | KHDRPZGVZNTKOT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 218.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.82 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|