C27H42N6O10 — CID 52993281
acetic acid;(2R)-5-(diaminomethylideneamino)-2-[[1-[(2R)-2-(phenylmethoxycarbonylamino)propanoyl]piperidine-4-carbonyl]amino]pentanoic acid (PubChem CID 52993281) has the molecular formula C27H42N6O10 and a molecular weight of 610.67 g/mol. Its IUPAC name is acetic acid;(2R)-5-(diaminomethylideneamino)-2-[[1-[(2R)-2-(phenylmethoxycarbonylamino)propanoyl]piperidine-4-carbonyl]amino]pentanoic acid.
| Compound Name | acetic acid;(2R)-5-(diaminomethylideneamino)-2-[[1-[(2R)-2-(phenylmethoxycarbonylamino)propanoyl]piperidine-4-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 52993281 |
| Molecular Formula | C27H42N6O10 |
| Molecular Weight | 610.67 g/mol |
| Exact Mass | 610.30 |
| IUPAC Name | acetic acid;(2R)-5-(diaminomethylideneamino)-2-[[1-[(2R)-2-(phenylmethoxycarbonylamino)propanoyl]piperidine-4-carbonyl]amino]pentanoic acid |
| SMILES | CC(=O)O.CC(=O)O.C[C@@H](NC(=O)OCc1ccccc1)C(=O)N1CCC(C(=O)N[C@H](CCCN=C(N)N)C(=O)O)CC1 |
| InChI | InChI=1S/C23H34N6O6.2C2H4O2/c1-15(27-23(34)35-14-16-6-3-2-4-7-16)20(31)29-12-9-17(10-13-29)19(30)28-18(21(32)33)8-5-11-26-22(24)25;2*1-2(3)4/h2-4,6-7,15,17-18H,5,8-14H2,1H3,(H,27,34)(H,28,30)(H,32,33)(H4,24,25,26);2*1H3,(H,3,4)/t15-,18-;;/m1../s1 |
| InChIKey | PGDJCMXLYGJMID-YXMFKPEJSA-N |
| XLogP | 0.34 |
| TPSA | 264.04 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.67 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|