C19H25N3O6 — CID 54412874
methyl (3S)-4-(4-carbamoylpiperidin-1-yl)-4-oxo-3-(phenylmethoxycarbonylamino)butanoate (PubChem CID 54412874) has the molecular formula C19H25N3O6 and a molecular weight of 391.42 g/mol. Its IUPAC name is methyl (3S)-4-(4-carbamoylpiperidin-1-yl)-4-oxo-3-(phenylmethoxycarbonylamino)butanoate.
| Compound Name | methyl (3S)-4-(4-carbamoylpiperidin-1-yl)-4-oxo-3-(phenylmethoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 54412874 |
| Molecular Formula | C19H25N3O6 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | methyl (3S)-4-(4-carbamoylpiperidin-1-yl)-4-oxo-3-(phenylmethoxycarbonylamino)butanoate |
| SMILES | COC(=O)C[C@H](NC(=O)OCc1ccccc1)C(=O)N1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C19H25N3O6/c1-27-16(23)11-15(18(25)22-9-7-14(8-10-22)17(20)24)21-19(26)28-12-13-5-3-2-4-6-13/h2-6,14-15H,7-12H2,1H3,(H2,20,24)(H,21,26)/t15-/m0/s1 |
| InChIKey | VVJAYRSNTATPDS-HNNXBMFYSA-N |
| XLogP | 0.57 |
| TPSA | 128.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |