C19H27N5O3S — CID 139592062
N-[(2S)-1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1,1-dihydroxypentan-2-yl]cyclopentanecarboxamide (PubChem CID 139592062) has the molecular formula C19H27N5O3S and a molecular weight of 405.52 g/mol. Its IUPAC name is N-[(2S)-1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1,1-dihydroxypentan-2-yl]cyclopentanecarboxamide.
| Compound Name | N-[(2S)-1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1,1-dihydroxypentan-2-yl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 139592062 |
| Molecular Formula | C19H27N5O3S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | N-[(2S)-1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1,1-dihydroxypentan-2-yl]cyclopentanecarboxamide |
| SMILES | NC(N)=NCCC[C@H](NC(=O)C1CCCC1)C(O)(O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C19H27N5O3S/c20-18(21)22-11-5-10-15(24-16(25)12-6-1-2-7-12)19(26,27)17-23-13-8-3-4-9-14(13)28-17/h3-4,8-9,12,15,26-27H,1-2,5-7,10-11H2,(H,24,25)(H4,20,21,22)/t15-/m0/s1 |
| InChIKey | PQHQZOSKNFGOIS-HNNXBMFYSA-N |
| XLogP | 1.16 |
| TPSA | 146.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|