C38H46N4O2 — CID 70854351
N-[2-[[(2S)-5-(cyclohexylamino)-1-(2,2-diphenylethylamino)-1-oxopentan-2-yl]amino]ethyl]naphthalene-2-carboxamide (PubChem CID 70854351) has the molecular formula C38H46N4O2 and a molecular weight of 590.81 g/mol. Its IUPAC name is N-[2-[[(2S)-5-(cyclohexylamino)-1-(2,2-diphenylethylamino)-1-oxopentan-2-yl]amino]ethyl]naphthalene-2-carboxamide.
| Compound Name | N-[2-[[(2S)-5-(cyclohexylamino)-1-(2,2-diphenylethylamino)-1-oxopentan-2-yl]amino]ethyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 70854351 |
| Molecular Formula | C38H46N4O2 |
| Molecular Weight | 590.81 g/mol |
| Exact Mass | 590.36 |
| IUPAC Name | N-[2-[[(2S)-5-(cyclohexylamino)-1-(2,2-diphenylethylamino)-1-oxopentan-2-yl]amino]ethyl]naphthalene-2-carboxamide |
| SMILES | O=C(NCCN[C@@H](CCCNC1CCCCC1)C(=O)NCC(c1ccccc1)c1ccccc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C38H46N4O2/c43-37(33-23-22-29-13-10-11-18-32(29)27-33)41-26-25-40-36(21-12-24-39-34-19-8-3-9-20-34)38(44)42-28-35(30-14-4-1-5-15-30)31-16-6-2-7-17-31/h1-2,4-7,10-11,13-18,22-23,27,34-36,39-40H,3,8-9,12,19-21,24-26,28H2,(H,41,43)(H,42,44)/t36-/m0/s1 |
| InChIKey | SUQYHZHWDBYTNR-BHVANESWSA-N |
| XLogP | 6.18 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.81 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|