C24H26N2O3 — CID 97247817
N-[3-[[(1R)-4-hydroxy-1-phenylbutyl]amino]-3-oxopropyl]naphthalene-2-carboxamide (PubChem CID 97247817) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is N-[3-[[(1R)-4-hydroxy-1-phenylbutyl]amino]-3-oxopropyl]naphthalene-2-carboxamide.
| Compound Name | N-[3-[[(1R)-4-hydroxy-1-phenylbutyl]amino]-3-oxopropyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 97247817 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | N-[3-[[(1R)-4-hydroxy-1-phenylbutyl]amino]-3-oxopropyl]naphthalene-2-carboxamide |
| SMILES | O=C(CCNC(=O)c1ccc2ccccc2c1)N[C@H](CCCO)c1ccccc1 |
| InChI | InChI=1S/C24H26N2O3/c27-16-6-11-22(19-8-2-1-3-9-19)26-23(28)14-15-25-24(29)21-13-12-18-7-4-5-10-20(18)17-21/h1-5,7-10,12-13,17,22,27H,6,11,14-16H2,(H,25,29)(H,26,28)/t22-/m1/s1 |
| InChIKey | RXDNIHBNRKJDOS-JOCHJYFZSA-N |
| XLogP | 3.59 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |