C22H21FN2O2 — CID 43056250
N-[3-[1-(4-fluorophenyl)ethylamino]-3-oxopropyl]naphthalene-2-carboxamide (PubChem CID 43056250) has the molecular formula C22H21FN2O2 and a molecular weight of 364.42 g/mol. Its IUPAC name is N-[3-[1-(4-fluorophenyl)ethylamino]-3-oxopropyl]naphthalene-2-carboxamide.
| Compound Name | N-[3-[1-(4-fluorophenyl)ethylamino]-3-oxopropyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 43056250 |
| Molecular Formula | C22H21FN2O2 |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | N-[3-[1-(4-fluorophenyl)ethylamino]-3-oxopropyl]naphthalene-2-carboxamide |
| SMILES | CC(NC(=O)CCNC(=O)c1ccc2ccccc2c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H21FN2O2/c1-15(16-8-10-20(23)11-9-16)25-21(26)12-13-24-22(27)19-7-6-17-4-2-3-5-18(17)14-19/h2-11,14-15H,12-13H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | BFNORFOWRRNYKL-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |