C19H22N2O4 — CID 119169798
3-methyl-2-[3-(naphthalene-2-carbonylamino)propanoylamino]butanoic acid (PubChem CID 119169798) has the molecular formula C19H22N2O4 and a molecular weight of 342.39 g/mol. Its IUPAC name is 3-methyl-2-[3-(naphthalene-2-carbonylamino)propanoylamino]butanoic acid.
| Compound Name | 3-methyl-2-[3-(naphthalene-2-carbonylamino)propanoylamino]butanoic acid |
|---|---|
| PubChem CID | 119169798 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 3-methyl-2-[3-(naphthalene-2-carbonylamino)propanoylamino]butanoic acid |
| SMILES | CC(C)C(NC(=O)CCNC(=O)c1ccc2ccccc2c1)C(=O)O |
| InChI | InChI=1S/C19H22N2O4/c1-12(2)17(19(24)25)21-16(22)9-10-20-18(23)15-8-7-13-5-3-4-6-14(13)11-15/h3-8,11-12,17H,9-10H2,1-2H3,(H,20,23)(H,21,22)(H,24,25) |
| InChIKey | IOWVYDKTGSJOIE-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |