C13H18N2O5 — CID 61136349
(2S)-2-[3-(furan-3-carbonylamino)propanoylamino]-3-methylbutanoic acid (PubChem CID 61136349) has the molecular formula C13H18N2O5 and a molecular weight of 282.30 g/mol. Its IUPAC name is (2S)-2-[3-(furan-3-carbonylamino)propanoylamino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[3-(furan-3-carbonylamino)propanoylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 61136349 |
| Molecular Formula | C13H18N2O5 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | (2S)-2-[3-(furan-3-carbonylamino)propanoylamino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)CCNC(=O)c1ccoc1)C(=O)O |
| InChI | InChI=1S/C13H18N2O5/c1-8(2)11(13(18)19)15-10(16)3-5-14-12(17)9-4-6-20-7-9/h4,6-8,11H,3,5H2,1-2H3,(H,14,17)(H,15,16)(H,18,19)/t11-/m0/s1 |
| InChIKey | JBOZJTMXTYGAHY-NSHDSACASA-N |
| XLogP | 0.62 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |