C17H27N3O5 — CID 46432538
ethyl N-[1-[3-(furan-3-carbonylamino)propanoylamino]-4-methylpentan-2-yl]carbamate (PubChem CID 46432538) has the molecular formula C17H27N3O5 and a molecular weight of 353.42 g/mol. Its IUPAC name is ethyl N-[1-[3-(furan-3-carbonylamino)propanoylamino]-4-methylpentan-2-yl]carbamate.
| Compound Name | ethyl N-[1-[3-(furan-3-carbonylamino)propanoylamino]-4-methylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 46432538 |
| Molecular Formula | C17H27N3O5 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | ethyl N-[1-[3-(furan-3-carbonylamino)propanoylamino]-4-methylpentan-2-yl]carbamate |
| SMILES | CCOC(=O)NC(CNC(=O)CCNC(=O)c1ccoc1)CC(C)C |
| InChI | InChI=1S/C17H27N3O5/c1-4-25-17(23)20-14(9-12(2)3)10-19-15(21)5-7-18-16(22)13-6-8-24-11-13/h6,8,11-12,14H,4-5,7,9-10H2,1-3H3,(H,18,22)(H,19,21)(H,20,23) |
| InChIKey | TVHJYPQYCRCMMR-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |