C15H24N2O4 — CID 103725537
N-[3-[2-(2-hydroxyethyl)pentylamino]-3-oxopropyl]furan-3-carboxamide (PubChem CID 103725537) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is N-[3-[2-(2-hydroxyethyl)pentylamino]-3-oxopropyl]furan-3-carboxamide.
| Compound Name | N-[3-[2-(2-hydroxyethyl)pentylamino]-3-oxopropyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 103725537 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | N-[3-[2-(2-hydroxyethyl)pentylamino]-3-oxopropyl]furan-3-carboxamide |
| SMILES | CCCC(CCO)CNC(=O)CCNC(=O)c1ccoc1 |
| InChI | InChI=1S/C15H24N2O4/c1-2-3-12(5-8-18)10-17-14(19)4-7-16-15(20)13-6-9-21-11-13/h6,9,11-12,18H,2-5,7-8,10H2,1H3,(H,16,20)(H,17,19) |
| InChIKey | MSQSRMXZFFRGIJ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |