C15H24N2 — CID 63321714
N'-cyclopentyl-1-phenylbutane-1,4-diamine (PubChem CID 63321714) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is N'-cyclopentyl-1-phenylbutane-1,4-diamine.
| Compound Name | N'-cyclopentyl-1-phenylbutane-1,4-diamine |
|---|---|
| PubChem CID | 63321714 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | N'-cyclopentyl-1-phenylbutane-1,4-diamine |
| SMILES | NC(CCCNC1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C15H24N2/c16-15(13-7-2-1-3-8-13)11-6-12-17-14-9-4-5-10-14/h1-3,7-8,14-15,17H,4-6,9-12,16H2 |
| InChIKey | BNSURRHXUKDVQE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|