C17H28N2 — CID 63656962
N'-(cyclopentylmethyl)-N'-methyl-1-phenylbutane-1,4-diamine (PubChem CID 63656962) has the molecular formula C17H28N2 and a molecular weight of 260.43 g/mol. Its IUPAC name is N'-(cyclopentylmethyl)-N'-methyl-1-phenylbutane-1,4-diamine.
| Compound Name | N'-(cyclopentylmethyl)-N'-methyl-1-phenylbutane-1,4-diamine |
|---|---|
| PubChem CID | 63656962 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | N'-(cyclopentylmethyl)-N'-methyl-1-phenylbutane-1,4-diamine |
| SMILES | CN(CCCC(N)c1ccccc1)CC1CCCC1 |
| InChI | InChI=1S/C17H28N2/c1-19(14-15-8-5-6-9-15)13-7-12-17(18)16-10-3-2-4-11-16/h2-4,10-11,15,17H,5-9,12-14,18H2,1H3 |
| InChIKey | IDUFEMZNAIMEIQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |