C16H26N2 — CID 81322135
2-[2-(aminomethyl)phenyl]-N-(cyclopentylmethyl)-N-methylethanamine (PubChem CID 81322135) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is 2-[2-(aminomethyl)phenyl]-N-(cyclopentylmethyl)-N-methylethanamine.
| Compound Name | 2-[2-(aminomethyl)phenyl]-N-(cyclopentylmethyl)-N-methylethanamine |
|---|---|
| PubChem CID | 81322135 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 2-[2-(aminomethyl)phenyl]-N-(cyclopentylmethyl)-N-methylethanamine |
| SMILES | CN(CCc1ccccc1CN)CC1CCCC1 |
| InChI | InChI=1S/C16H26N2/c1-18(13-14-6-2-3-7-14)11-10-15-8-4-5-9-16(15)12-17/h4-5,8-9,14H,2-3,6-7,10-13,17H2,1H3 |
| InChIKey | FNFDATHCAADECN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |