About N'-(cyclopentylmethyl)-N'-methylethane-1,2-diamine
N'-(cyclopentylmethyl)-N'-methylethane-1,2-diamine (PubChem CID 55151127) has the molecular formula C9H20N2
and a molecular weight of 156.27 g/mol. Its IUPAC name is N'-(cyclopentylmethyl)-N'-methylethane-1,2-diamine.
Analyze N'-(cyclopentylmethyl)-N'-methylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(cyclopentylmethyl)-N'-methylethane-1,2-diamine?
The IUPAC name of N'-(cyclopentylmethyl)-N'-methylethane-1,2-diamine (CID 55151127) is N'-(cyclopentylmethyl)-N'-methylethane-1,2-diamine.
What is the SMILES notation for N'-(cyclopentylmethyl)-N'-methylethane-1,2-diamine?
The canonical SMILES for N'-(cyclopentylmethyl)-N'-methylethane-1,2-diamine is CN(CCN)CC1CCCC1.
What is the InChIKey of N'-(cyclopentylmethyl)-N'-methylethane-1,2-diamine?
The InChIKey is ZSKFTQBPPULDBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2/c1-11(7-6-10)8-9-4-2-3-5-9/h9H,2-8,10H2,1H3.
What are the key properties of N'-(cyclopentylmethyl)-N'-methylethane-1,2-diamine?
N'-(cyclopentylmethyl)-N'-methylethane-1,2-diamine has a molecular weight of 156.27 g/mol, XLogP of 1.07, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(cyclopentylmethyl)-N'-methylethane-1,2-diamine is sourced from PubChem (CID 55151127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).