C17H28N2 — CID 63831434
N'-[(1-methylcyclopentyl)methyl]-1-phenylbutane-1,4-diamine (PubChem CID 63831434) has the molecular formula C17H28N2 and a molecular weight of 260.42 g/mol. Its IUPAC name is N'-[(1-methylcyclopentyl)methyl]-1-phenylbutane-1,4-diamine.
| Compound Name | N'-[(1-methylcyclopentyl)methyl]-1-phenylbutane-1,4-diamine |
|---|---|
| PubChem CID | 63831434 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | N'-[(1-methylcyclopentyl)methyl]-1-phenylbutane-1,4-diamine |
| SMILES | CC1(CNCCCC(N)c2ccccc2)CCCC1 |
| InChI | InChI=1S/C17H28N2/c1-17(11-5-6-12-17)14-19-13-7-10-16(18)15-8-3-2-4-9-15/h2-4,8-9,16,19H,5-7,10-14,18H2,1H3 |
| InChIKey | TXPPVJQRJCQUCO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|