C24H26N4O4S2 — CID 54282731
benzyl 3-[[2-(4-carbamothioylbenzoyl)imino-3,4-dimethyl-1,3-thiazolidine-5-carbonyl]amino]propanoate (PubChem CID 54282731) has the molecular formula C24H26N4O4S2 and a molecular weight of 498.63 g/mol. Its IUPAC name is benzyl 3-[[2-(4-carbamothioylbenzoyl)imino-3,4-dimethyl-1,3-thiazolidine-5-carbonyl]amino]propanoate.
| Compound Name | benzyl 3-[[2-(4-carbamothioylbenzoyl)imino-3,4-dimethyl-1,3-thiazolidine-5-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 54282731 |
| Molecular Formula | C24H26N4O4S2 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | benzyl 3-[[2-(4-carbamothioylbenzoyl)imino-3,4-dimethyl-1,3-thiazolidine-5-carbonyl]amino]propanoate |
| SMILES | CC1C(C(=O)NCCC(=O)OCc2ccccc2)S/C(=N/C(=O)c2ccc(C(N)=S)cc2)N1C |
| InChI | InChI=1S/C24H26N4O4S2/c1-15-20(23(31)26-13-12-19(29)32-14-16-6-4-3-5-7-16)34-24(28(15)2)27-22(30)18-10-8-17(9-11-18)21(25)33/h3-11,15,20H,12-14H2,1-2H3,(H2,25,33)(H,26,31)/b27-24+ |
| InChIKey | RRYBQXOPQTYUCK-SOYKGTTHSA-N |
| XLogP | 2.50 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|