C25H33N5O6S — CID 67682129
methyl 4-[[amino-[4-[[3-cyclopropyl-5-[(3-methoxy-3-oxopropyl)carbamoyl]-4-methyl-1,3-thiazolidin-2-ylidene]carbamoyl]phenyl]methylidene]amino]butanoate (PubChem CID 67682129) has the molecular formula C25H33N5O6S and a molecular weight of 531.64 g/mol. Its IUPAC name is methyl 4-[[amino-[4-[[3-cyclopropyl-5-[(3-methoxy-3-oxopropyl)carbamoyl]-4-methyl-1,3-thiazolidin-2-ylidene]carbamoyl]phenyl]methylidene]amino]butanoate.
| Compound Name | methyl 4-[[amino-[4-[[3-cyclopropyl-5-[(3-methoxy-3-oxopropyl)carbamoyl]-4-methyl-1,3-thiazolidin-2-ylidene]carbamoyl]phenyl]methylidene]amino]butanoate |
|---|---|
| PubChem CID | 67682129 |
| Molecular Formula | C25H33N5O6S |
| Molecular Weight | 531.64 g/mol |
| Exact Mass | 531.22 |
| IUPAC Name | methyl 4-[[amino-[4-[[3-cyclopropyl-5-[(3-methoxy-3-oxopropyl)carbamoyl]-4-methyl-1,3-thiazolidin-2-ylidene]carbamoyl]phenyl]methylidene]amino]butanoate |
| SMILES | COC(=O)CCC/N=C(\N)c1ccc(C(=O)/N=C2\SC(C(=O)NCCC(=O)OC)C(C)N2C2CC2)cc1 |
| InChI | InChI=1S/C25H33N5O6S/c1-15-21(24(34)28-14-12-20(32)36-3)37-25(30(15)18-10-11-18)29-23(33)17-8-6-16(7-9-17)22(26)27-13-4-5-19(31)35-2/h6-9,15,18,21H,4-5,10-14H2,1-3H3,(H2,26,27)(H,28,34)/b29-25- |
| InChIKey | KKLZRIKZNLZECI-GNVQSUKOSA-N |
| XLogP | 1.49 |
| TPSA | 152.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.64 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|