C11H11NO3S — CID 141204086
2-(3,4-dimethoxyphenoxy)-1,3-thiazole (PubChem CID 141204086) has the molecular formula C11H11NO3S and a molecular weight of 237.28 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenoxy)-1,3-thiazole.
| Compound Name | 2-(3,4-dimethoxyphenoxy)-1,3-thiazole |
|---|---|
| PubChem CID | 141204086 |
| Molecular Formula | C11H11NO3S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 2-(3,4-dimethoxyphenoxy)-1,3-thiazole |
| SMILES | COc1ccc(Oc2nccs2)cc1OC |
| InChI | InChI=1S/C11H11NO3S/c1-13-9-4-3-8(7-10(9)14-2)15-11-12-5-6-16-11/h3-7H,1-2H3 |
| InChIKey | YYJRDLWDUWOGEZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |