C17H15F3N2O4 — CID 70060767
3-(7-carbamimidoyl-2-methoxynaphthalen-1-yl)oxyprop-1-enyl 2,2,2-trifluoroacetate (PubChem CID 70060767) has the molecular formula C17H15F3N2O4 and a molecular weight of 368.31 g/mol. Its IUPAC name is 3-(7-carbamimidoyl-2-methoxynaphthalen-1-yl)oxyprop-1-enyl 2,2,2-trifluoroacetate.
| Compound Name | 3-(7-carbamimidoyl-2-methoxynaphthalen-1-yl)oxyprop-1-enyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 70060767 |
| Molecular Formula | C17H15F3N2O4 |
| Molecular Weight | 368.31 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 3-(7-carbamimidoyl-2-methoxynaphthalen-1-yl)oxyprop-1-enyl 2,2,2-trifluoroacetate |
| SMILES | [H]/N=C(\N)c1ccc2ccc(OC)c(OCC=COC(=O)C(F)(F)F)c2c1 |
| InChI | InChI=1S/C17H15F3N2O4/c1-24-13-6-5-10-3-4-11(15(21)22)9-12(10)14(13)25-7-2-8-26-16(23)17(18,19)20/h2-6,8-9H,7H2,1H3,(H3,21,22) |
| InChIKey | NYQFDVPOCQYPOQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 94.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.31 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|