C15H13F3N2O4 — CID 70058828
(2-carbamimidoyl-7,8-dimethoxynaphthalen-1-yl) 2,2,2-trifluoroacetate (PubChem CID 70058828) has the molecular formula C15H13F3N2O4 and a molecular weight of 342.27 g/mol. Its IUPAC name is (2-carbamimidoyl-7,8-dimethoxynaphthalen-1-yl) 2,2,2-trifluoroacetate.
| Compound Name | (2-carbamimidoyl-7,8-dimethoxynaphthalen-1-yl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 70058828 |
| Molecular Formula | C15H13F3N2O4 |
| Molecular Weight | 342.27 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | (2-carbamimidoyl-7,8-dimethoxynaphthalen-1-yl) 2,2,2-trifluoroacetate |
| SMILES | [H]/N=C(\N)c1ccc2ccc(OC)c(OC)c2c1OC(=O)C(F)(F)F |
| InChI | InChI=1S/C15H13F3N2O4/c1-22-9-6-4-7-3-5-8(13(19)20)11(10(7)12(9)23-2)24-14(21)15(16,17)18/h3-6H,1-2H3,(H3,19,20) |
| InChIKey | VGQVNWQGHUZJLM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 94.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.27 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|