C25H21N3O6S — CID 70005967
2-(6-carbamimidoylnaphthalen-2-yl)oxy-5-[(4-methoxyphenyl)sulfonylamino]benzoic acid (PubChem CID 70005967) has the molecular formula C25H21N3O6S and a molecular weight of 491.53 g/mol. Its IUPAC name is 2-(6-carbamimidoylnaphthalen-2-yl)oxy-5-[(4-methoxyphenyl)sulfonylamino]benzoic acid.
| Compound Name | 2-(6-carbamimidoylnaphthalen-2-yl)oxy-5-[(4-methoxyphenyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 70005967 |
| Molecular Formula | C25H21N3O6S |
| Molecular Weight | 491.53 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | 2-(6-carbamimidoylnaphthalen-2-yl)oxy-5-[(4-methoxyphenyl)sulfonylamino]benzoic acid |
| SMILES | [H]/N=C(\N)c1ccc2cc(Oc3ccc(NS(=O)(=O)c4ccc(OC)cc4)cc3C(=O)O)ccc2c1 |
| InChI | InChI=1S/C25H21N3O6S/c1-33-19-7-9-21(10-8-19)35(31,32)28-18-5-11-23(22(14-18)25(29)30)34-20-6-4-15-12-17(24(26)27)3-2-16(15)13-20/h2-14,28H,1H3,(H3,26,27)(H,29,30) |
| InChIKey | FKLDIWOARLEKIT-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 151.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.53 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|