C34H30Cl2N4O4S — CID 22380947
4-[2-(6-carbamimidoylnaphthalen-2-yl)oxy-5-[(3,4-dichlorophenyl)sulfonylamino]phenyl]-N-(2-methylpropyl)benzamide (PubChem CID 22380947) has the molecular formula C34H30Cl2N4O4S and a molecular weight of 661.61 g/mol. Its IUPAC name is 4-[2-(6-carbamimidoylnaphthalen-2-yl)oxy-5-[(3,4-dichlorophenyl)sulfonylamino]phenyl]-N-(2-methylpropyl)benzamide.
| Compound Name | 4-[2-(6-carbamimidoylnaphthalen-2-yl)oxy-5-[(3,4-dichlorophenyl)sulfonylamino]phenyl]-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 22380947 |
| Molecular Formula | C34H30Cl2N4O4S |
| Molecular Weight | 661.61 g/mol |
| Exact Mass | 660.14 |
| IUPAC Name | 4-[2-(6-carbamimidoylnaphthalen-2-yl)oxy-5-[(3,4-dichlorophenyl)sulfonylamino]phenyl]-N-(2-methylpropyl)benzamide |
| SMILES | [H]/N=C(\N)c1ccc2cc(Oc3ccc(NS(=O)(=O)c4ccc(Cl)c(Cl)c4)cc3-c3ccc(C(=O)NCC(C)C)cc3)ccc2c1 |
| InChI | InChI=1S/C34H30Cl2N4O4S/c1-20(2)19-39-34(41)22-5-3-21(4-6-22)29-17-26(40-45(42,43)28-12-13-30(35)31(36)18-28)10-14-32(29)44-27-11-9-23-15-25(33(37)38)8-7-24(23)16-27/h3-18,20,40H,19H2,1-2H3,(H3,37,38)(H,39,41) |
| InChIKey | KJMMNQLPWIZEHH-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 134.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.61 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|